About 3-ethoxy-5,5,6-trimethylcyclohex-2-en-1-one
3-ethoxy-5,5,6-trimethylcyclohex-2-en-1-one (PubChem CID 11217620) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is 3-ethoxy-5,5,6-trimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 3-ethoxy-5,5,6-trimethylcyclohex-2-en-1-one |
| PubChem CID | 11217620 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 3-ethoxy-5,5,6-trimethylcyclohex-2-en-1-one |
| SMILES | CCOC1=CC(=O)C(C)C(C)(C)C1 |
| InChI | InChI=1S/C11H18O2/c1-5-13-9-6-10(12)8(2)11(3,4)7-9/h6,8H,5,7H2,1-4H3 |
| InChIKey | ZPAUWSOFUGCSTD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethoxy-5,5,6-trimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-5,5,6-trimethylcyclohex-2-en-1-one?
The IUPAC name of 3-ethoxy-5,5,6-trimethylcyclohex-2-en-1-one (CID 11217620) is 3-ethoxy-5,5,6-trimethylcyclohex-2-en-1-one.
What is the SMILES notation for 3-ethoxy-5,5,6-trimethylcyclohex-2-en-1-one?
The canonical SMILES for 3-ethoxy-5,5,6-trimethylcyclohex-2-en-1-one is CCOC1=CC(=O)C(C)C(C)(C)C1.
What is the InChIKey of 3-ethoxy-5,5,6-trimethylcyclohex-2-en-1-one?
The InChIKey is ZPAUWSOFUGCSTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c1-5-13-9-6-10(12)8(2)11(3,4)7-9/h6,8H,5,7H2,1-4H3.
What are the key properties of 3-ethoxy-5,5,6-trimethylcyclohex-2-en-1-one?
3-ethoxy-5,5,6-trimethylcyclohex-2-en-1-one has a molecular weight of 182.26 g/mol, XLogP of 2.54, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-5,5,6-trimethylcyclohex-2-en-1-one is sourced from PubChem (CID 11217620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).