C13H18O — CID 11217734
(4S,7R,8S,11R)-5,5,9-trimethyl-3-oxatetracyclo[5.3.1.01,8.04,11]undec-9-ene (PubChem CID 11217734) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is (4S,7R,8S,11R)-5,5,9-trimethyl-3-oxatetracyclo[5.3.1.01,8.04,11]undec-9-ene.
| Compound Name | (4S,7R,8S,11R)-5,5,9-trimethyl-3-oxatetracyclo[5.3.1.01,8.04,11]undec-9-ene |
|---|---|
| PubChem CID | 11217734 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | (4S,7R,8S,11R)-5,5,9-trimethyl-3-oxatetracyclo[5.3.1.01,8.04,11]undec-9-ene |
| SMILES | CC1=CC23CO[C@H]4[C@@H]2[C@H](CC4(C)C)[C@@H]13 |
| InChI | InChI=1S/C13H18O/c1-7-4-13-6-14-11-10(13)8(9(7)13)5-12(11,2)3/h4,8-11H,5-6H2,1-3H3/t8-,9-,10+,11+,13?/m1/s1 |
| InChIKey | HJNGSSKIKPBNHD-JAUYCLJESA-N |
| XLogP | 2.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|