About 5-ethynyl-5-methoxy-3,3-dimethylocta-1,7-diene
5-ethynyl-5-methoxy-3,3-dimethylocta-1,7-diene (PubChem CID 11217759) has the molecular formula C13H20O
and a molecular weight of 192.30 g/mol. Its IUPAC name is 5-ethynyl-5-methoxy-3,3-dimethylocta-1,7-diene.
Molecular Properties
| Compound Name | 5-ethynyl-5-methoxy-3,3-dimethylocta-1,7-diene |
| PubChem CID | 11217759 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 5-ethynyl-5-methoxy-3,3-dimethylocta-1,7-diene |
| SMILES | C#CC(CC=C)(CC(C)(C)C=C)OC |
| InChI | InChI=1S/C13H20O/c1-7-10-13(9-3,14-6)11-12(4,5)8-2/h3,7-8H,1-2,10-11H2,4-6H3 |
| InChIKey | UEMHSZQGMSCBJM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethynyl-5-methoxy-3,3-dimethylocta-1,7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethynyl-5-methoxy-3,3-dimethylocta-1,7-diene?
The IUPAC name of 5-ethynyl-5-methoxy-3,3-dimethylocta-1,7-diene (CID 11217759) is 5-ethynyl-5-methoxy-3,3-dimethylocta-1,7-diene.
What is the SMILES notation for 5-ethynyl-5-methoxy-3,3-dimethylocta-1,7-diene?
The canonical SMILES for 5-ethynyl-5-methoxy-3,3-dimethylocta-1,7-diene is C#CC(CC=C)(CC(C)(C)C=C)OC.
What is the InChIKey of 5-ethynyl-5-methoxy-3,3-dimethylocta-1,7-diene?
The InChIKey is UEMHSZQGMSCBJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O/c1-7-10-13(9-3,14-6)11-12(4,5)8-2/h3,7-8H,1-2,10-11H2,4-6H3.
What are the key properties of 5-ethynyl-5-methoxy-3,3-dimethylocta-1,7-diene?
5-ethynyl-5-methoxy-3,3-dimethylocta-1,7-diene has a molecular weight of 192.30 g/mol, XLogP of 3.18, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethynyl-5-methoxy-3,3-dimethylocta-1,7-diene is sourced from PubChem (CID 11217759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).