About (1S,5S)-3-methyl-13-azatricyclo[7.3.1.05,13]tridecane
(1S,5S)-3-methyl-13-azatricyclo[7.3.1.05,13]tridecane (PubChem CID 11217776) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is (1S,5S)-3-methyl-13-azatricyclo[7.3.1.05,13]tridecane.
Molecular Properties
| Compound Name | (1S,5S)-3-methyl-13-azatricyclo[7.3.1.05,13]tridecane |
| PubChem CID | 11217776 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (1S,5S)-3-methyl-13-azatricyclo[7.3.1.05,13]tridecane |
| SMILES | CC1C[C@@H]2CCCC3CCC[C@@H](C1)N32 |
| InChI | InChI=1S/C13H23N/c1-10-8-12-6-2-4-11-5-3-7-13(9-10)14(11)12/h10-13H,2-9H2,1H3/t10?,11?,12-,13-/m0/s1 |
| InChIKey | MOQNYBQLQBMEKL-TYUFSLCMSA-N |
| XLogP | 3.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S,5S)-3-methyl-13-azatricyclo[7.3.1.05,13]tridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5S)-3-methyl-13-azatricyclo[7.3.1.05,13]tridecane?
The IUPAC name of (1S,5S)-3-methyl-13-azatricyclo[7.3.1.05,13]tridecane (CID 11217776) is (1S,5S)-3-methyl-13-azatricyclo[7.3.1.05,13]tridecane.
What is the SMILES notation for (1S,5S)-3-methyl-13-azatricyclo[7.3.1.05,13]tridecane?
The canonical SMILES for (1S,5S)-3-methyl-13-azatricyclo[7.3.1.05,13]tridecane is CC1C[C@@H]2CCCC3CCC[C@@H](C1)N32.
What is the InChIKey of (1S,5S)-3-methyl-13-azatricyclo[7.3.1.05,13]tridecane?
The InChIKey is MOQNYBQLQBMEKL-TYUFSLCMSA-N. The full InChI is InChI=1S/C13H23N/c1-10-8-12-6-2-4-11-5-3-7-13(9-10)14(11)12/h10-13H,2-9H2,1H3/t10?,11?,12-,13-/m0/s1.
What are the key properties of (1S,5S)-3-methyl-13-azatricyclo[7.3.1.05,13]tridecane?
(1S,5S)-3-methyl-13-azatricyclo[7.3.1.05,13]tridecane has a molecular weight of 193.33 g/mol, XLogP of 3.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5S)-3-methyl-13-azatricyclo[7.3.1.05,13]tridecane is sourced from PubChem (CID 11217776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).