C11H17NO2 — CID 11217799
methyl 2,3,5,6,7,9a-hexahydro-1H-pyrrolo[1,2-a]azepine-9-carboxylate (PubChem CID 11217799) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is methyl 2,3,5,6,7,9a-hexahydro-1H-pyrrolo[1,2-a]azepine-9-carboxylate.
| Compound Name | methyl 2,3,5,6,7,9a-hexahydro-1H-pyrrolo[1,2-a]azepine-9-carboxylate |
|---|---|
| PubChem CID | 11217799 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | methyl 2,3,5,6,7,9a-hexahydro-1H-pyrrolo[1,2-a]azepine-9-carboxylate |
| SMILES | COC(=O)C1=CCCCN2CCCC12 |
| InChI | InChI=1S/C11H17NO2/c1-14-11(13)9-5-2-3-7-12-8-4-6-10(9)12/h5,10H,2-4,6-8H2,1H3 |
| InChIKey | WWCXLIPJAGTRBH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |