C10H22O4 — CID 11218000
(3R,4R)-2,5-dimethoxy-2,5-dimethylhexane-3,4-diol (PubChem CID 11218000) has the molecular formula C10H22O4 and a molecular weight of 206.28 g/mol. Its IUPAC name is (3R,4R)-2,5-dimethoxy-2,5-dimethylhexane-3,4-diol.
| Compound Name | (3R,4R)-2,5-dimethoxy-2,5-dimethylhexane-3,4-diol |
|---|---|
| PubChem CID | 11218000 |
| Molecular Formula | C10H22O4 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | (3R,4R)-2,5-dimethoxy-2,5-dimethylhexane-3,4-diol |
| SMILES | COC(C)(C)[C@H](O)[C@@H](O)C(C)(C)OC |
| InChI | InChI=1S/C10H22O4/c1-9(2,13-5)7(11)8(12)10(3,4)14-6/h7-8,11-12H,1-6H3/t7-,8-/m1/s1 |
| InChIKey | NULZQLNMRPLHRP-HTQZYQBOSA-N |
| XLogP | 0.56 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |