About phenyl 2-pyridin-4-ylacetate
phenyl 2-pyridin-4-ylacetate (PubChem CID 11218132) has the molecular formula C13H11NO2
and a molecular weight of 213.24 g/mol. Its IUPAC name is phenyl 2-pyridin-4-ylacetate.
Molecular Properties
| Compound Name | phenyl 2-pyridin-4-ylacetate |
| PubChem CID | 11218132 |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | phenyl 2-pyridin-4-ylacetate |
| SMILES | O=C(Cc1ccncc1)Oc1ccccc1 |
| InChI | InChI=1S/C13H11NO2/c15-13(10-11-6-8-14-9-7-11)16-12-4-2-1-3-5-12/h1-9H,10H2 |
| InChIKey | VTYICJGIGXCMFA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 2-pyridin-4-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 2-pyridin-4-ylacetate?
The IUPAC name of phenyl 2-pyridin-4-ylacetate (CID 11218132) is phenyl 2-pyridin-4-ylacetate.
What is the SMILES notation for phenyl 2-pyridin-4-ylacetate?
The canonical SMILES for phenyl 2-pyridin-4-ylacetate is O=C(Cc1ccncc1)Oc1ccccc1.
What is the InChIKey of phenyl 2-pyridin-4-ylacetate?
The InChIKey is VTYICJGIGXCMFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO2/c15-13(10-11-6-8-14-9-7-11)16-12-4-2-1-3-5-12/h1-9H,10H2.
What are the key properties of phenyl 2-pyridin-4-ylacetate?
phenyl 2-pyridin-4-ylacetate has a molecular weight of 213.24 g/mol, XLogP of 2.23, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 2-pyridin-4-ylacetate is sourced from PubChem (CID 11218132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).