About quinolin-7-yl N,N-dimethylcarbamate
quinolin-7-yl N,N-dimethylcarbamate (PubChem CID 11218314) has the molecular formula C12H12N2O2
and a molecular weight of 216.24 g/mol. Its IUPAC name is quinolin-7-yl N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | quinolin-7-yl N,N-dimethylcarbamate |
| PubChem CID | 11218314 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | quinolin-7-yl N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1ccc2cccnc2c1 |
| InChI | InChI=1S/C12H12N2O2/c1-14(2)12(15)16-10-6-5-9-4-3-7-13-11(9)8-10/h3-8H,1-2H3 |
| InChIKey | IOGBSPBEMWFBFB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze quinolin-7-yl N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-7-yl N,N-dimethylcarbamate?
The IUPAC name of quinolin-7-yl N,N-dimethylcarbamate (CID 11218314) is quinolin-7-yl N,N-dimethylcarbamate.
What is the SMILES notation for quinolin-7-yl N,N-dimethylcarbamate?
The canonical SMILES for quinolin-7-yl N,N-dimethylcarbamate is CN(C)C(=O)Oc1ccc2cccnc2c1.
What is the InChIKey of quinolin-7-yl N,N-dimethylcarbamate?
The InChIKey is IOGBSPBEMWFBFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2/c1-14(2)12(15)16-10-6-5-9-4-3-7-13-11(9)8-10/h3-8H,1-2H3.
What are the key properties of quinolin-7-yl N,N-dimethylcarbamate?
quinolin-7-yl N,N-dimethylcarbamate has a molecular weight of 216.24 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-7-yl N,N-dimethylcarbamate is sourced from PubChem (CID 11218314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).