C14H16O3 — CID 11218515
(1'R,2'S,6'R,7'S)-2'-methylspiro[1,3-dioxolane-2,11'-tricyclo[5.2.2.02,6]undeca-4,8-diene]-3'-one (PubChem CID 11218515) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is (1'R,2'S,6'R,7'S)-2'-methylspiro[1,3-dioxolane-2,11'-tricyclo[5.2.2.02,6]undeca-4,8-diene]-3'-one.
| Compound Name | (1'R,2'S,6'R,7'S)-2'-methylspiro[1,3-dioxolane-2,11'-tricyclo[5.2.2.02,6]undeca-4,8-diene]-3'-one |
|---|---|
| PubChem CID | 11218515 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | (1'R,2'S,6'R,7'S)-2'-methylspiro[1,3-dioxolane-2,11'-tricyclo[5.2.2.02,6]undeca-4,8-diene]-3'-one |
| SMILES | C[C@@]12C(=O)C=C[C@@H]1[C@@H]1C=C[C@H]2CC12OCCO2 |
| InChI | InChI=1S/C14H16O3/c1-13-9-2-3-11(10(13)4-5-12(13)15)14(8-9)16-6-7-17-14/h2-5,9-11H,6-8H2,1H3/t9-,10+,11-,13-/m0/s1 |
| InChIKey | OCNBVGDQCFHIML-NOHGZBONSA-N |
| XLogP | 1.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|