About 1-(4-nitrophenyl)ethyl methanesulfonate
1-(4-nitrophenyl)ethyl methanesulfonate (PubChem CID 11218799) has the molecular formula C9H11NO5S
and a molecular weight of 245.26 g/mol. Its IUPAC name is 1-(4-nitrophenyl)ethyl methanesulfonate.
Molecular Properties
| Compound Name | 1-(4-nitrophenyl)ethyl methanesulfonate |
| PubChem CID | 11218799 |
| Molecular Formula | C9H11NO5S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 1-(4-nitrophenyl)ethyl methanesulfonate |
| SMILES | CC(OS(C)(=O)=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H11NO5S/c1-7(15-16(2,13)14)8-3-5-9(6-4-8)10(11)12/h3-7H,1-2H3 |
| InChIKey | IGMAFPHZTNBADO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-nitrophenyl)ethyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-nitrophenyl)ethyl methanesulfonate?
The IUPAC name of 1-(4-nitrophenyl)ethyl methanesulfonate (CID 11218799) is 1-(4-nitrophenyl)ethyl methanesulfonate.
What is the SMILES notation for 1-(4-nitrophenyl)ethyl methanesulfonate?
The canonical SMILES for 1-(4-nitrophenyl)ethyl methanesulfonate is CC(OS(C)(=O)=O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 1-(4-nitrophenyl)ethyl methanesulfonate?
The InChIKey is IGMAFPHZTNBADO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO5S/c1-7(15-16(2,13)14)8-3-5-9(6-4-8)10(11)12/h3-7H,1-2H3.
What are the key properties of 1-(4-nitrophenyl)ethyl methanesulfonate?
1-(4-nitrophenyl)ethyl methanesulfonate has a molecular weight of 245.26 g/mol, XLogP of 1.63, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-nitrophenyl)ethyl methanesulfonate is sourced from PubChem (CID 11218799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).