About 4-butyl-5,7-dimethoxy-1,2-dihydronaphthalene
4-butyl-5,7-dimethoxy-1,2-dihydronaphthalene (PubChem CID 11218833) has the molecular formula C16H22O2
and a molecular weight of 246.35 g/mol. Its IUPAC name is 4-butyl-5,7-dimethoxy-1,2-dihydronaphthalene.
Molecular Properties
| Compound Name | 4-butyl-5,7-dimethoxy-1,2-dihydronaphthalene |
| PubChem CID | 11218833 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 4-butyl-5,7-dimethoxy-1,2-dihydronaphthalene |
| SMILES | CCCCC1=CCCc2cc(OC)cc(OC)c21 |
| InChI | InChI=1S/C16H22O2/c1-4-5-7-12-8-6-9-13-10-14(17-2)11-15(18-3)16(12)13/h8,10-11H,4-7,9H2,1-3H3 |
| InChIKey | WHDTZZHXLCBFGB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-butyl-5,7-dimethoxy-1,2-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-5,7-dimethoxy-1,2-dihydronaphthalene?
The IUPAC name of 4-butyl-5,7-dimethoxy-1,2-dihydronaphthalene (CID 11218833) is 4-butyl-5,7-dimethoxy-1,2-dihydronaphthalene.
What is the SMILES notation for 4-butyl-5,7-dimethoxy-1,2-dihydronaphthalene?
The canonical SMILES for 4-butyl-5,7-dimethoxy-1,2-dihydronaphthalene is CCCCC1=CCCc2cc(OC)cc(OC)c21.
What is the InChIKey of 4-butyl-5,7-dimethoxy-1,2-dihydronaphthalene?
The InChIKey is WHDTZZHXLCBFGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O2/c1-4-5-7-12-8-6-9-13-10-14(17-2)11-15(18-3)16(12)13/h8,10-11H,4-7,9H2,1-3H3.
What are the key properties of 4-butyl-5,7-dimethoxy-1,2-dihydronaphthalene?
4-butyl-5,7-dimethoxy-1,2-dihydronaphthalene has a molecular weight of 246.35 g/mol, XLogP of 4.22, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-5,7-dimethoxy-1,2-dihydronaphthalene is sourced from PubChem (CID 11218833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).