C10H15BrO2 — CID 11218846
(3R,5S,6S)-6-(3-bromoprop-1-en-2-yl)-3,5-dimethyloxan-2-one (PubChem CID 11218846) has the molecular formula C10H15BrO2 and a molecular weight of 247.13 g/mol. Its IUPAC name is (3R,5S,6S)-6-(3-bromoprop-1-en-2-yl)-3,5-dimethyloxan-2-one.
| Compound Name | (3R,5S,6S)-6-(3-bromoprop-1-en-2-yl)-3,5-dimethyloxan-2-one |
|---|---|
| PubChem CID | 11218846 |
| Molecular Formula | C10H15BrO2 |
| Molecular Weight | 247.13 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | (3R,5S,6S)-6-(3-bromoprop-1-en-2-yl)-3,5-dimethyloxan-2-one |
| SMILES | C=C(CBr)[C@H]1OC(=O)[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C10H15BrO2/c1-6-4-7(2)10(12)13-9(6)8(3)5-11/h6-7,9H,3-5H2,1-2H3/t6-,7+,9-/m0/s1 |
| InChIKey | HBACHRKPCFMVHL-OOZYFLPDSA-N |
| XLogP | 2.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.13 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|