About 5,6-dihydroisoquinolino[1,2-b]quinazolin-8-imine
5,6-dihydroisoquinolino[1,2-b]quinazolin-8-imine (PubChem CID 11218853) has the molecular formula C16H13N3
and a molecular weight of 247.30 g/mol. Its IUPAC name is 5,6-dihydroisoquinolino[1,2-b]quinazolin-8-imine.
Molecular Properties
| Compound Name | 5,6-dihydroisoquinolino[1,2-b]quinazolin-8-imine |
| PubChem CID | 11218853 |
| Molecular Formula | C16H13N3 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 5,6-dihydroisoquinolino[1,2-b]quinazolin-8-imine |
| SMILES | [H]/N=c1\c2ccccc2nc2n1CCc1ccccc1-2 |
| InChI | InChI=1S/C16H13N3/c17-15-13-7-3-4-8-14(13)18-16-12-6-2-1-5-11(12)9-10-19(15)16/h1-8,17H,9-10H2/b17-15+ |
| InChIKey | LJFVUNRZHCODLW-BMRADRMJSA-N |
| XLogP | 2.74 |
| TPSA | 41.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,6-dihydroisoquinolino[1,2-b]quinazolin-8-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydroisoquinolino[1,2-b]quinazolin-8-imine?
The IUPAC name of 5,6-dihydroisoquinolino[1,2-b]quinazolin-8-imine (CID 11218853) is 5,6-dihydroisoquinolino[1,2-b]quinazolin-8-imine.
What is the SMILES notation for 5,6-dihydroisoquinolino[1,2-b]quinazolin-8-imine?
The canonical SMILES for 5,6-dihydroisoquinolino[1,2-b]quinazolin-8-imine is [H]/N=c1\c2ccccc2nc2n1CCc1ccccc1-2.
What is the InChIKey of 5,6-dihydroisoquinolino[1,2-b]quinazolin-8-imine?
The InChIKey is LJFVUNRZHCODLW-BMRADRMJSA-N. The full InChI is InChI=1S/C16H13N3/c17-15-13-7-3-4-8-14(13)18-16-12-6-2-1-5-11(12)9-10-19(15)16/h1-8,17H,9-10H2/b17-15+.
What are the key properties of 5,6-dihydroisoquinolino[1,2-b]quinazolin-8-imine?
5,6-dihydroisoquinolino[1,2-b]quinazolin-8-imine has a molecular weight of 247.30 g/mol, XLogP of 2.74, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydroisoquinolino[1,2-b]quinazolin-8-imine is sourced from PubChem (CID 11218853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).