C15H20OS — CID 11218879
(2R,4aR,10bR)-2,5,5-trimethyl-3,4,4a,10b-tetrahydro-2H-thiochromeno[4,3-b]pyran (PubChem CID 11218879) has the molecular formula C15H20OS and a molecular weight of 248.39 g/mol. Its IUPAC name is (2R,4aR,10bR)-2,5,5-trimethyl-3,4,4a,10b-tetrahydro-2H-thiochromeno[4,3-b]pyran.
| Compound Name | (2R,4aR,10bR)-2,5,5-trimethyl-3,4,4a,10b-tetrahydro-2H-thiochromeno[4,3-b]pyran |
|---|---|
| PubChem CID | 11218879 |
| Molecular Formula | C15H20OS |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (2R,4aR,10bR)-2,5,5-trimethyl-3,4,4a,10b-tetrahydro-2H-thiochromeno[4,3-b]pyran |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](O1)c1ccccc1SC2(C)C |
| InChI | InChI=1S/C15H20OS/c1-10-8-9-12-14(16-10)11-6-4-5-7-13(11)17-15(12,2)3/h4-7,10,12,14H,8-9H2,1-3H3/t10-,12-,14+/m1/s1 |
| InChIKey | LMHJLKCQACOSGB-QKCSRTOESA-N |
| XLogP | 4.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |