About pyridin-2-ylmethyl 3-phenylbutanoate
pyridin-2-ylmethyl 3-phenylbutanoate (PubChem CID 11219036) has the molecular formula C16H17NO2
and a molecular weight of 255.32 g/mol. Its IUPAC name is pyridin-2-ylmethyl 3-phenylbutanoate.
Molecular Properties
| Compound Name | pyridin-2-ylmethyl 3-phenylbutanoate |
| PubChem CID | 11219036 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | pyridin-2-ylmethyl 3-phenylbutanoate |
| SMILES | CC(CC(=O)OCc1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C16H17NO2/c1-13(14-7-3-2-4-8-14)11-16(18)19-12-15-9-5-6-10-17-15/h2-10,13H,11-12H2,1H3 |
| InChIKey | IUWPMWMVKDCWAV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyridin-2-ylmethyl 3-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-ylmethyl 3-phenylbutanoate?
The IUPAC name of pyridin-2-ylmethyl 3-phenylbutanoate (CID 11219036) is pyridin-2-ylmethyl 3-phenylbutanoate.
What is the SMILES notation for pyridin-2-ylmethyl 3-phenylbutanoate?
The canonical SMILES for pyridin-2-ylmethyl 3-phenylbutanoate is CC(CC(=O)OCc1ccccn1)c1ccccc1.
What is the InChIKey of pyridin-2-ylmethyl 3-phenylbutanoate?
The InChIKey is IUWPMWMVKDCWAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO2/c1-13(14-7-3-2-4-8-14)11-16(18)19-12-15-9-5-6-10-17-15/h2-10,13H,11-12H2,1H3.
What are the key properties of pyridin-2-ylmethyl 3-phenylbutanoate?
pyridin-2-ylmethyl 3-phenylbutanoate has a molecular weight of 255.32 g/mol, XLogP of 3.32, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-ylmethyl 3-phenylbutanoate is sourced from PubChem (CID 11219036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).