About [(E)-dodec-9-enyl] dihydrogen phosphate
[(E)-dodec-9-enyl] dihydrogen phosphate (PubChem CID 11219269) has the molecular formula C12H25O4P
and a molecular weight of 264.30 g/mol. Its IUPAC name is [(E)-dodec-9-enyl] dihydrogen phosphate.
Molecular Properties
| Compound Name | [(E)-dodec-9-enyl] dihydrogen phosphate |
| PubChem CID | 11219269 |
| Molecular Formula | C12H25O4P |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | [(E)-dodec-9-enyl] dihydrogen phosphate |
| SMILES | CC/C=C/CCCCCCCCOP(=O)(O)O |
| InChI | InChI=1S/C12H25O4P/c1-2-3-4-5-6-7-8-9-10-11-12-16-17(13,14)15/h3-4H,2,5-12H2,1H3,(H2,13,14,15)/b4-3+ |
| InChIKey | FSJUVXSBVQARLY-ONEGZZNKSA-N |
| XLogP | 3.79 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(E)-dodec-9-enyl] dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-dodec-9-enyl] dihydrogen phosphate?
The IUPAC name of [(E)-dodec-9-enyl] dihydrogen phosphate (CID 11219269) is [(E)-dodec-9-enyl] dihydrogen phosphate.
What is the SMILES notation for [(E)-dodec-9-enyl] dihydrogen phosphate?
The canonical SMILES for [(E)-dodec-9-enyl] dihydrogen phosphate is CC/C=C/CCCCCCCCOP(=O)(O)O.
What is the InChIKey of [(E)-dodec-9-enyl] dihydrogen phosphate?
The InChIKey is FSJUVXSBVQARLY-ONEGZZNKSA-N. The full InChI is InChI=1S/C12H25O4P/c1-2-3-4-5-6-7-8-9-10-11-12-16-17(13,14)15/h3-4H,2,5-12H2,1H3,(H2,13,14,15)/b4-3+.
What are the key properties of [(E)-dodec-9-enyl] dihydrogen phosphate?
[(E)-dodec-9-enyl] dihydrogen phosphate has a molecular weight of 264.30 g/mol, XLogP of 3.79, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-dodec-9-enyl] dihydrogen phosphate is sourced from PubChem (CID 11219269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).