C15H22O4 — CID 11219328
diethyl (4Z)-3-methylidene-4-propylidenecyclopentane-1,1-dicarboxylate (PubChem CID 11219328) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is diethyl (4Z)-3-methylidene-4-propylidenecyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl (4Z)-3-methylidene-4-propylidenecyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11219328 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | diethyl (4Z)-3-methylidene-4-propylidenecyclopentane-1,1-dicarboxylate |
| SMILES | C=C1CC(C(=O)OCC)(C(=O)OCC)C/C1=C/CC |
| InChI | InChI=1S/C15H22O4/c1-5-8-12-10-15(9-11(12)4,13(16)18-6-2)14(17)19-7-3/h8H,4-7,9-10H2,1-3H3/b12-8- |
| InChIKey | NISBGAMNCWPXOZ-WQLSENKSSA-N |
| XLogP | 2.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|