C17H18N2O — CID 11219330
(4S,5S)-1,3-dimethyl-4,5-diphenylimidazolidin-2-one (PubChem CID 11219330) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is (4S,5S)-1,3-dimethyl-4,5-diphenylimidazolidin-2-one.
| Compound Name | (4S,5S)-1,3-dimethyl-4,5-diphenylimidazolidin-2-one |
|---|---|
| PubChem CID | 11219330 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | (4S,5S)-1,3-dimethyl-4,5-diphenylimidazolidin-2-one |
| SMILES | CN1C(=O)N(C)[C@@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H18N2O/c1-18-15(13-9-5-3-6-10-13)16(19(2)17(18)20)14-11-7-4-8-12-14/h3-12,15-16H,1-2H3/t15-,16-/m0/s1 |
| InChIKey | VDNQPGJZCBMFEH-HOTGVXAUSA-N |
| XLogP | 3.47 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |