C15H26O2Si — CID 11219335
2-[[(1S,2S,5R)-2-bicyclo[3.2.2]nona-3,6-dienyl]oxymethoxy]ethyl-trimethylsilane (PubChem CID 11219335) has the molecular formula C15H26O2Si and a molecular weight of 266.46 g/mol. Its IUPAC name is 2-[[(1S,2S,5R)-2-bicyclo[3.2.2]nona-3,6-dienyl]oxymethoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[(1S,2S,5R)-2-bicyclo[3.2.2]nona-3,6-dienyl]oxymethoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 11219335 |
| Molecular Formula | C15H26O2Si |
| Molecular Weight | 266.46 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2-[[(1S,2S,5R)-2-bicyclo[3.2.2]nona-3,6-dienyl]oxymethoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCO[C@H]1C=C[C@H]2C=C[C@@H]1CC2 |
| InChI | InChI=1S/C15H26O2Si/c1-18(2,3)11-10-16-12-17-15-9-6-13-4-7-14(15)8-5-13/h4,6-7,9,13-15H,5,8,10-12H2,1-3H3/t13-,14+,15-/m0/s1 |
| InChIKey | WWEWCFCDSXNOLS-ZNMIVQPWSA-N |
| XLogP | 3.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|