About 2-methylpropyl 2-acetylsulfanyl-4,4,4-trifluorobutanoate
2-methylpropyl 2-acetylsulfanyl-4,4,4-trifluorobutanoate (PubChem CID 11219492) has the molecular formula C10H15F3O3S
and a molecular weight of 272.29 g/mol. Its IUPAC name is 2-methylpropyl 2-acetylsulfanyl-4,4,4-trifluorobutanoate.
Molecular Properties
| Compound Name | 2-methylpropyl 2-acetylsulfanyl-4,4,4-trifluorobutanoate |
| PubChem CID | 11219492 |
| Molecular Formula | C10H15F3O3S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-methylpropyl 2-acetylsulfanyl-4,4,4-trifluorobutanoate |
| SMILES | CC(=O)SC(CC(F)(F)F)C(=O)OCC(C)C |
| InChI | InChI=1S/C10H15F3O3S/c1-6(2)5-16-9(15)8(17-7(3)14)4-10(11,12)13/h6,8H,4-5H2,1-3H3 |
| InChIKey | JGROJAUVOWOMLQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 2-acetylsulfanyl-4,4,4-trifluorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 2-acetylsulfanyl-4,4,4-trifluorobutanoate?
The IUPAC name of 2-methylpropyl 2-acetylsulfanyl-4,4,4-trifluorobutanoate (CID 11219492) is 2-methylpropyl 2-acetylsulfanyl-4,4,4-trifluorobutanoate.
What is the SMILES notation for 2-methylpropyl 2-acetylsulfanyl-4,4,4-trifluorobutanoate?
The canonical SMILES for 2-methylpropyl 2-acetylsulfanyl-4,4,4-trifluorobutanoate is CC(=O)SC(CC(F)(F)F)C(=O)OCC(C)C.
What is the InChIKey of 2-methylpropyl 2-acetylsulfanyl-4,4,4-trifluorobutanoate?
The InChIKey is JGROJAUVOWOMLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F3O3S/c1-6(2)5-16-9(15)8(17-7(3)14)4-10(11,12)13/h6,8H,4-5H2,1-3H3.
What are the key properties of 2-methylpropyl 2-acetylsulfanyl-4,4,4-trifluorobutanoate?
2-methylpropyl 2-acetylsulfanyl-4,4,4-trifluorobutanoate has a molecular weight of 272.29 g/mol, XLogP of 2.79, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 2-acetylsulfanyl-4,4,4-trifluorobutanoate is sourced from PubChem (CID 11219492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).