C14H15NO5 — CID 11219639
[(E)-3-(4-nitrophenyl)prop-2-enoyl] 2,2-dimethylpropanoate (PubChem CID 11219639) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is [(E)-3-(4-nitrophenyl)prop-2-enoyl] 2,2-dimethylpropanoate.
| Compound Name | [(E)-3-(4-nitrophenyl)prop-2-enoyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11219639 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | [(E)-3-(4-nitrophenyl)prop-2-enoyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC(=O)/C=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H15NO5/c1-14(2,3)13(17)20-12(16)9-6-10-4-7-11(8-5-10)15(18)19/h4-9H,1-3H3/b9-6+ |
| InChIKey | JCHAPSACQCSFBN-RMKNXTFCSA-N |
| XLogP | 2.72 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|