C17H29NO2 — CID 11219718
tert-butyl (2S,3S,6R)-6-methyl-2,3-bis(prop-2-enyl)piperidine-1-carboxylate (PubChem CID 11219718) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is tert-butyl (2S,3S,6R)-6-methyl-2,3-bis(prop-2-enyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S,6R)-6-methyl-2,3-bis(prop-2-enyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11219718 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | tert-butyl (2S,3S,6R)-6-methyl-2,3-bis(prop-2-enyl)piperidine-1-carboxylate |
| SMILES | C=CC[C@@H]1CC[C@@H](C)N(C(=O)OC(C)(C)C)[C@H]1CC=C |
| InChI | InChI=1S/C17H29NO2/c1-7-9-14-12-11-13(3)18(15(14)10-8-2)16(19)20-17(4,5)6/h7-8,13-15H,1-2,9-12H2,3-6H3/t13-,14-,15+/m1/s1 |
| InChIKey | SMBXWHQNSUSVSJ-KFWWJZLASA-N |
| XLogP | 4.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|