C17H14O2S — CID 11219794
(4S)-4-ethenylspiro[1,3-oxathiolane-2,9'-xanthene] (PubChem CID 11219794) has the molecular formula C17H14O2S and a molecular weight of 282.36 g/mol. Its IUPAC name is (4S)-4-ethenylspiro[1,3-oxathiolane-2,9'-xanthene].
| Compound Name | (4S)-4-ethenylspiro[1,3-oxathiolane-2,9'-xanthene] |
|---|---|
| PubChem CID | 11219794 |
| Molecular Formula | C17H14O2S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | (4S)-4-ethenylspiro[1,3-oxathiolane-2,9'-xanthene] |
| SMILES | C=C[C@H]1COC2(S1)c1ccccc1Oc1ccccc12 |
| InChI | InChI=1S/C17H14O2S/c1-2-12-11-18-17(20-12)13-7-3-5-9-15(13)19-16-10-6-4-8-14(16)17/h2-10,12H,1,11H2/t12-/m0/s1 |
| InChIKey | NETYHRJPBJAJFD-LBPRGKRZSA-N |
| XLogP | 4.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|