C15H26O5 — CID 11219899
ethyl 2-[(1S,5S)-1-hexyl-2,3,8-trioxabicyclo[3.2.1]octan-4-yl]acetate (PubChem CID 11219899) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is ethyl 2-[(1S,5S)-1-hexyl-2,3,8-trioxabicyclo[3.2.1]octan-4-yl]acetate.
| Compound Name | ethyl 2-[(1S,5S)-1-hexyl-2,3,8-trioxabicyclo[3.2.1]octan-4-yl]acetate |
|---|---|
| PubChem CID | 11219899 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | ethyl 2-[(1S,5S)-1-hexyl-2,3,8-trioxabicyclo[3.2.1]octan-4-yl]acetate |
| SMILES | CCCCCC[C@]12CC[C@H](O1)C(CC(=O)OCC)OO2 |
| InChI | InChI=1S/C15H26O5/c1-3-5-6-7-9-15-10-8-12(18-15)13(19-20-15)11-14(16)17-4-2/h12-13H,3-11H2,1-2H3/t12-,13?,15-/m0/s1 |
| InChIKey | DTKDEXGDJJMXBP-YOYPFHDYSA-N |
| XLogP | 3.12 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|