C19H19NO3 — CID 11220584
(4S)-5,5-dimethyl-4-phenyl-3-[(2R,3S)-3-phenyloxiran-2-yl]-1,3-oxazolidin-2-one (PubChem CID 11220584) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is (4S)-5,5-dimethyl-4-phenyl-3-[(2R,3S)-3-phenyloxiran-2-yl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-5,5-dimethyl-4-phenyl-3-[(2R,3S)-3-phenyloxiran-2-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11220584 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (4S)-5,5-dimethyl-4-phenyl-3-[(2R,3S)-3-phenyloxiran-2-yl]-1,3-oxazolidin-2-one |
| SMILES | CC1(C)OC(=O)N([C@@H]2O[C@H]2c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H19NO3/c1-19(2)16(14-11-7-4-8-12-14)20(18(21)23-19)17-15(22-17)13-9-5-3-6-10-13/h3-12,15-17H,1-2H3/t15-,16-,17+/m0/s1 |
| InChIKey | ZRMTUSVZAHDTKK-YESZJQIVSA-N |
| XLogP | 4.06 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|