C17H30N2O3 — CID 11220628
ethyl 2-[1-[(piperidine-4-carbonylamino)methyl]cyclohexyl]acetate (PubChem CID 11220628) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is ethyl 2-[1-[(piperidine-4-carbonylamino)methyl]cyclohexyl]acetate.
| Compound Name | ethyl 2-[1-[(piperidine-4-carbonylamino)methyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 11220628 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | ethyl 2-[1-[(piperidine-4-carbonylamino)methyl]cyclohexyl]acetate |
| SMILES | CCOC(=O)CC1(CNC(=O)C2CCNCC2)CCCCC1 |
| InChI | InChI=1S/C17H30N2O3/c1-2-22-15(20)12-17(8-4-3-5-9-17)13-19-16(21)14-6-10-18-11-7-14/h14,18H,2-13H2,1H3,(H,19,21) |
| InChIKey | SNTDBXVHNLOCJA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |