About 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclopentylurea
3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclopentylurea (PubChem CID 11220735) has the molecular formula C14H20ClN3OS
and a molecular weight of 313.85 g/mol. Its IUPAC name is 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclopentylurea.
Molecular Properties
| Compound Name | 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclopentylurea |
| PubChem CID | 11220735 |
| Molecular Formula | C14H20ClN3OS |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclopentylurea |
| SMILES | O=C(Nc1ncc(Cl)s1)N(C1CCCC1)C1CCCC1 |
| InChI | InChI=1S/C14H20ClN3OS/c15-12-9-16-13(20-12)17-14(19)18(10-5-1-2-6-10)11-7-3-4-8-11/h9-11H,1-8H2,(H,16,17,19) |
| InChIKey | PUNGGLOBQNMLIY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclopentylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclopentylurea?
The IUPAC name of 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclopentylurea (CID 11220735) is 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclopentylurea.
What is the SMILES notation for 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclopentylurea?
The canonical SMILES for 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclopentylurea is O=C(Nc1ncc(Cl)s1)N(C1CCCC1)C1CCCC1.
What is the InChIKey of 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclopentylurea?
The InChIKey is PUNGGLOBQNMLIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClN3OS/c15-12-9-16-13(20-12)17-14(19)18(10-5-1-2-6-10)11-7-3-4-8-11/h9-11H,1-8H2,(H,16,17,19).
What are the key properties of 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclopentylurea?
3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclopentylurea has a molecular weight of 313.85 g/mol, XLogP of 4.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclopentylurea is sourced from PubChem (CID 11220735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).