About 2-chloro-3-(4-phenylphenyl)-6,7-dihydro-5H-1,4-dithiepine
2-chloro-3-(4-phenylphenyl)-6,7-dihydro-5H-1,4-dithiepine (PubChem CID 11220878) has the molecular formula C17H15ClS2
and a molecular weight of 318.89 g/mol. Its IUPAC name is 2-chloro-3-(4-phenylphenyl)-6,7-dihydro-5H-1,4-dithiepine.
Molecular Properties
| Compound Name | 2-chloro-3-(4-phenylphenyl)-6,7-dihydro-5H-1,4-dithiepine |
| PubChem CID | 11220878 |
| Molecular Formula | C17H15ClS2 |
| Molecular Weight | 318.89 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 2-chloro-3-(4-phenylphenyl)-6,7-dihydro-5H-1,4-dithiepine |
| SMILES | ClC1=C(c2ccc(-c3ccccc3)cc2)SCCCS1 |
| InChI | InChI=1S/C17H15ClS2/c18-17-16(19-11-4-12-20-17)15-9-7-14(8-10-15)13-5-2-1-3-6-13/h1-3,5-10H,4,11-12H2 |
| InChIKey | VPMRDQFZKANKLM-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.89 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-3-(4-phenylphenyl)-6,7-dihydro-5H-1,4-dithiepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-(4-phenylphenyl)-6,7-dihydro-5H-1,4-dithiepine?
The IUPAC name of 2-chloro-3-(4-phenylphenyl)-6,7-dihydro-5H-1,4-dithiepine (CID 11220878) is 2-chloro-3-(4-phenylphenyl)-6,7-dihydro-5H-1,4-dithiepine.
What is the SMILES notation for 2-chloro-3-(4-phenylphenyl)-6,7-dihydro-5H-1,4-dithiepine?
The canonical SMILES for 2-chloro-3-(4-phenylphenyl)-6,7-dihydro-5H-1,4-dithiepine is ClC1=C(c2ccc(-c3ccccc3)cc2)SCCCS1.
What is the InChIKey of 2-chloro-3-(4-phenylphenyl)-6,7-dihydro-5H-1,4-dithiepine?
The InChIKey is VPMRDQFZKANKLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClS2/c18-17-16(19-11-4-12-20-17)15-9-7-14(8-10-15)13-5-2-1-3-6-13/h1-3,5-10H,4,11-12H2.
What are the key properties of 2-chloro-3-(4-phenylphenyl)-6,7-dihydro-5H-1,4-dithiepine?
2-chloro-3-(4-phenylphenyl)-6,7-dihydro-5H-1,4-dithiepine has a molecular weight of 318.89 g/mol, XLogP of 6.09, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-(4-phenylphenyl)-6,7-dihydro-5H-1,4-dithiepine is sourced from PubChem (CID 11220878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).