About ethyl 3-(benzhydrylamino)-2,2-difluoropropanoate
ethyl 3-(benzhydrylamino)-2,2-difluoropropanoate (PubChem CID 11220884) has the molecular formula C18H19F2NO2
and a molecular weight of 319.35 g/mol. Its IUPAC name is ethyl 3-(benzhydrylamino)-2,2-difluoropropanoate.
Molecular Properties
| Compound Name | ethyl 3-(benzhydrylamino)-2,2-difluoropropanoate |
| PubChem CID | 11220884 |
| Molecular Formula | C18H19F2NO2 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | ethyl 3-(benzhydrylamino)-2,2-difluoropropanoate |
| SMILES | CCOC(=O)C(F)(F)CNC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19F2NO2/c1-2-23-17(22)18(19,20)13-21-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,16,21H,2,13H2,1H3 |
| InChIKey | AORCZWNXHQYMLI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-(benzhydrylamino)-2,2-difluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(benzhydrylamino)-2,2-difluoropropanoate?
The IUPAC name of ethyl 3-(benzhydrylamino)-2,2-difluoropropanoate (CID 11220884) is ethyl 3-(benzhydrylamino)-2,2-difluoropropanoate.
What is the SMILES notation for ethyl 3-(benzhydrylamino)-2,2-difluoropropanoate?
The canonical SMILES for ethyl 3-(benzhydrylamino)-2,2-difluoropropanoate is CCOC(=O)C(F)(F)CNC(c1ccccc1)c1ccccc1.
What is the InChIKey of ethyl 3-(benzhydrylamino)-2,2-difluoropropanoate?
The InChIKey is AORCZWNXHQYMLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19F2NO2/c1-2-23-17(22)18(19,20)13-21-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,16,21H,2,13H2,1H3.
What are the key properties of ethyl 3-(benzhydrylamino)-2,2-difluoropropanoate?
ethyl 3-(benzhydrylamino)-2,2-difluoropropanoate has a molecular weight of 319.35 g/mol, XLogP of 3.56, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(benzhydrylamino)-2,2-difluoropropanoate is sourced from PubChem (CID 11220884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).