C18H14FN3O2 — CID 11220997
2-(4-fluorophenyl)-3-[(E)-hydroxyiminomethyl]-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-9-one (PubChem CID 11220997) has the molecular formula C18H14FN3O2 and a molecular weight of 323.33 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-[(E)-hydroxyiminomethyl]-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-9-one.
| Compound Name | 2-(4-fluorophenyl)-3-[(E)-hydroxyiminomethyl]-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-9-one |
|---|---|
| PubChem CID | 11220997 |
| Molecular Formula | C18H14FN3O2 |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 2-(4-fluorophenyl)-3-[(E)-hydroxyiminomethyl]-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-9-one |
| SMILES | O=C1NCCn2c(-c3ccc(F)cc3)c(/C=N/O)c3cccc1c32 |
| InChI | InChI=1S/C18H14FN3O2/c19-12-6-4-11(5-7-12)16-15(10-21-24)13-2-1-3-14-17(13)22(16)9-8-20-18(14)23/h1-7,10,24H,8-9H2,(H,20,23)/b21-10+ |
| InChIKey | DZFLWZCKPVJFAH-UFFVCSGVSA-N |
| XLogP | 3.00 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|