About quinoxalino[3,2-f][1,10]phenanthroline-11-carboxylic acid
quinoxalino[3,2-f][1,10]phenanthroline-11-carboxylic acid (PubChem CID 11221079) has the molecular formula C19H10N4O2
and a molecular weight of 326.32 g/mol. Its IUPAC name is quinoxalino[3,2-f][1,10]phenanthroline-11-carboxylic acid.
Molecular Properties
| Compound Name | quinoxalino[3,2-f][1,10]phenanthroline-11-carboxylic acid |
| PubChem CID | 11221079 |
| Molecular Formula | C19H10N4O2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | quinoxalino[3,2-f][1,10]phenanthroline-11-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc3c4cccnc4c4ncccc4c3nc2c1 |
| InChI | InChI=1S/C19H10N4O2/c24-19(25)10-5-6-13-14(9-10)23-18-12-4-2-8-21-16(12)15-11(17(18)22-13)3-1-7-20-15/h1-9H,(H,24,25) |
| InChIKey | JKBDXDNPNLMMHQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze quinoxalino[3,2-f][1,10]phenanthroline-11-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoxalino[3,2-f][1,10]phenanthroline-11-carboxylic acid?
The IUPAC name of quinoxalino[3,2-f][1,10]phenanthroline-11-carboxylic acid (CID 11221079) is quinoxalino[3,2-f][1,10]phenanthroline-11-carboxylic acid.
What is the SMILES notation for quinoxalino[3,2-f][1,10]phenanthroline-11-carboxylic acid?
The canonical SMILES for quinoxalino[3,2-f][1,10]phenanthroline-11-carboxylic acid is O=C(O)c1ccc2nc3c4cccnc4c4ncccc4c3nc2c1.
What is the InChIKey of quinoxalino[3,2-f][1,10]phenanthroline-11-carboxylic acid?
The InChIKey is JKBDXDNPNLMMHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H10N4O2/c24-19(25)10-5-6-13-14(9-10)23-18-12-4-2-8-21-16(12)15-11(17(18)22-13)3-1-7-20-15/h1-9H,(H,24,25).
What are the key properties of quinoxalino[3,2-f][1,10]phenanthroline-11-carboxylic acid?
quinoxalino[3,2-f][1,10]phenanthroline-11-carboxylic acid has a molecular weight of 326.32 g/mol, XLogP of 3.58, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for quinoxalino[3,2-f][1,10]phenanthroline-11-carboxylic acid is sourced from PubChem (CID 11221079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).