About ethyl 2-decyl-1,3-dithiane-2-carboxylate
ethyl 2-decyl-1,3-dithiane-2-carboxylate (PubChem CID 11221264) has the molecular formula C17H32O2S2
and a molecular weight of 332.58 g/mol. Its IUPAC name is ethyl 2-decyl-1,3-dithiane-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-decyl-1,3-dithiane-2-carboxylate |
| PubChem CID | 11221264 |
| Molecular Formula | C17H32O2S2 |
| Molecular Weight | 332.58 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | ethyl 2-decyl-1,3-dithiane-2-carboxylate |
| SMILES | CCCCCCCCCCC1(C(=O)OCC)SCCCS1 |
| InChI | InChI=1S/C17H32O2S2/c1-3-5-6-7-8-9-10-11-13-17(16(18)19-4-2)20-14-12-15-21-17/h3-15H2,1-2H3 |
| InChIKey | DBHSNGLEPAQYCY-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.58 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-decyl-1,3-dithiane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-decyl-1,3-dithiane-2-carboxylate?
The IUPAC name of ethyl 2-decyl-1,3-dithiane-2-carboxylate (CID 11221264) is ethyl 2-decyl-1,3-dithiane-2-carboxylate.
What is the SMILES notation for ethyl 2-decyl-1,3-dithiane-2-carboxylate?
The canonical SMILES for ethyl 2-decyl-1,3-dithiane-2-carboxylate is CCCCCCCCCCC1(C(=O)OCC)SCCCS1.
What is the InChIKey of ethyl 2-decyl-1,3-dithiane-2-carboxylate?
The InChIKey is DBHSNGLEPAQYCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O2S2/c1-3-5-6-7-8-9-10-11-13-17(16(18)19-4-2)20-14-12-15-21-17/h3-15H2,1-2H3.
What are the key properties of ethyl 2-decyl-1,3-dithiane-2-carboxylate?
ethyl 2-decyl-1,3-dithiane-2-carboxylate has a molecular weight of 332.58 g/mol, XLogP of 5.65, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-decyl-1,3-dithiane-2-carboxylate is sourced from PubChem (CID 11221264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).