C16H16N2O3V — CID 11221267
(6Z)-6-[[2-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one;oxovanadium (PubChem CID 11221267) has the molecular formula C16H16N2O3V and a molecular weight of 335.26 g/mol. Its IUPAC name is (6Z)-6-[[2-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one;oxovanadium.
| Compound Name | (6Z)-6-[[2-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one;oxovanadium |
|---|---|
| PubChem CID | 11221267 |
| Molecular Formula | C16H16N2O3V |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | (6Z)-6-[[2-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one;oxovanadium |
| SMILES | O=C1C=CC=C/C1=C/NCCN/C=C1/C=CC=CC1=O.O=[V] |
| InChI | InChI=1S/C16H16N2O2.O.V/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;;/h1-8,11-12,17-18H,9-10H2;;/b13-11-,14-12-;; |
| InChIKey | LBBJJHRHJWVXQH-MVGPTFNUSA-N |
| XLogP | 1.20 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|