About methyl 2-[(2R,4R,6S)-6-methoxy-4-(2-trimethylsilylethoxymethoxy)oxan-2-yl]acetate
methyl 2-[(2R,4R,6S)-6-methoxy-4-(2-trimethylsilylethoxymethoxy)oxan-2-yl]acetate (PubChem CID 11221338) has the molecular formula C15H30O6Si
and a molecular weight of 334.49 g/mol. Its IUPAC name is methyl 2-[(2R,4R,6S)-6-methoxy-4-(2-trimethylsilylethoxymethoxy)oxan-2-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(2R,4R,6S)-6-methoxy-4-(2-trimethylsilylethoxymethoxy)oxan-2-yl]acetate |
| PubChem CID | 11221338 |
| Molecular Formula | C15H30O6Si |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | methyl 2-[(2R,4R,6S)-6-methoxy-4-(2-trimethylsilylethoxymethoxy)oxan-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1C[C@@H](OCOCC[Si](C)(C)C)C[C@@H](OC)O1 |
| InChI | InChI=1S/C15H30O6Si/c1-17-14(16)9-13-8-12(10-15(18-2)21-13)20-11-19-6-7-22(3,4)5/h12-13,15H,6-11H2,1-5H3/t12-,13-,15+/m1/s1 |
| InChIKey | SAALLGDZJUOCFX-NFAWXSAZSA-N |
| XLogP | 2.40 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(2R,4R,6S)-6-methoxy-4-(2-trimethylsilylethoxymethoxy)oxan-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2R,4R,6S)-6-methoxy-4-(2-trimethylsilylethoxymethoxy)oxan-2-yl]acetate?
The IUPAC name of methyl 2-[(2R,4R,6S)-6-methoxy-4-(2-trimethylsilylethoxymethoxy)oxan-2-yl]acetate (CID 11221338) is methyl 2-[(2R,4R,6S)-6-methoxy-4-(2-trimethylsilylethoxymethoxy)oxan-2-yl]acetate.
What is the SMILES notation for methyl 2-[(2R,4R,6S)-6-methoxy-4-(2-trimethylsilylethoxymethoxy)oxan-2-yl]acetate?
The canonical SMILES for methyl 2-[(2R,4R,6S)-6-methoxy-4-(2-trimethylsilylethoxymethoxy)oxan-2-yl]acetate is COC(=O)C[C@H]1C[C@@H](OCOCC[Si](C)(C)C)C[C@@H](OC)O1.
What is the InChIKey of methyl 2-[(2R,4R,6S)-6-methoxy-4-(2-trimethylsilylethoxymethoxy)oxan-2-yl]acetate?
The InChIKey is SAALLGDZJUOCFX-NFAWXSAZSA-N. The full InChI is InChI=1S/C15H30O6Si/c1-17-14(16)9-13-8-12(10-15(18-2)21-13)20-11-19-6-7-22(3,4)5/h12-13,15H,6-11H2,1-5H3/t12-,13-,15+/m1/s1.
What are the key properties of methyl 2-[(2R,4R,6S)-6-methoxy-4-(2-trimethylsilylethoxymethoxy)oxan-2-yl]acetate?
methyl 2-[(2R,4R,6S)-6-methoxy-4-(2-trimethylsilylethoxymethoxy)oxan-2-yl]acetate has a molecular weight of 334.49 g/mol, XLogP of 2.40, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2R,4R,6S)-6-methoxy-4-(2-trimethylsilylethoxymethoxy)oxan-2-yl]acetate is sourced from PubChem (CID 11221338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).