C21H27NOSi — CID 11221416
(3S,4R,5S)-4-[benzhydryl(dimethyl)silyl]-3,5-dimethylpyrrolidin-2-one (PubChem CID 11221416) has the molecular formula C21H27NOSi and a molecular weight of 337.54 g/mol. Its IUPAC name is (3S,4R,5S)-4-[benzhydryl(dimethyl)silyl]-3,5-dimethylpyrrolidin-2-one.
| Compound Name | (3S,4R,5S)-4-[benzhydryl(dimethyl)silyl]-3,5-dimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 11221416 |
| Molecular Formula | C21H27NOSi |
| Molecular Weight | 337.54 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (3S,4R,5S)-4-[benzhydryl(dimethyl)silyl]-3,5-dimethylpyrrolidin-2-one |
| SMILES | C[C@@H]1NC(=O)[C@H](C)[C@H]1[Si](C)(C)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NOSi/c1-15-19(16(2)22-21(15)23)24(3,4)20(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-16,19-20H,1-4H3,(H,22,23)/t15-,16+,19-/m1/s1 |
| InChIKey | CMDWLXCAHJCBFN-JTDSTZFVSA-N |
| XLogP | 4.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.54 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|