C22H32O3 — CID 11221641
(2R,6R,7R,12R,14S)-4,4,7,17,18,18-hexamethyl-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadeca-1(17),9-dien-13-one (PubChem CID 11221641) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (2R,6R,7R,12R,14S)-4,4,7,17,18,18-hexamethyl-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadeca-1(17),9-dien-13-one.
| Compound Name | (2R,6R,7R,12R,14S)-4,4,7,17,18,18-hexamethyl-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadeca-1(17),9-dien-13-one |
|---|---|
| PubChem CID | 11221641 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (2R,6R,7R,12R,14S)-4,4,7,17,18,18-hexamethyl-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadeca-1(17),9-dien-13-one |
| SMILES | CC1=C2[C@H]3OC(C)(C)O[C@@H]3[C@]3(C)CC=CC[C@H]3C(=O)[C@@H](CC1)C2(C)C |
| InChI | InChI=1S/C22H32O3/c1-13-10-11-14-17(23)15-9-7-8-12-22(15,6)19-18(16(13)20(14,2)3)24-21(4,5)25-19/h7-8,14-15,18-19H,9-12H2,1-6H3/t14-,15+,18-,19+,22-/m1/s1 |
| InChIKey | FJVUBZWODSDDLD-MUYGHKMISA-N |
| XLogP | 4.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|