About 2-[(E)-3-[2,4,6-tri(propan-2-yl)phenyl]prop-1-enoxy]oxane
2-[(E)-3-[2,4,6-tri(propan-2-yl)phenyl]prop-1-enoxy]oxane (PubChem CID 11221645) has the molecular formula C23H36O2
and a molecular weight of 344.54 g/mol. Its IUPAC name is 2-[(E)-3-[2,4,6-tri(propan-2-yl)phenyl]prop-1-enoxy]oxane.
Molecular Properties
| Compound Name | 2-[(E)-3-[2,4,6-tri(propan-2-yl)phenyl]prop-1-enoxy]oxane |
| PubChem CID | 11221645 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | 2-[(E)-3-[2,4,6-tri(propan-2-yl)phenyl]prop-1-enoxy]oxane |
| SMILES | CC(C)c1cc(C(C)C)c(C/C=C/OC2CCCCO2)c(C(C)C)c1 |
| InChI | InChI=1S/C23H36O2/c1-16(2)19-14-21(17(3)4)20(22(15-19)18(5)6)10-9-13-25-23-11-7-8-12-24-23/h9,13-18,23H,7-8,10-12H2,1-6H3/b13-9+ |
| InChIKey | FLCRLHPPZBQDTR-UKTHLTGXSA-N |
| XLogP | 6.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-3-[2,4,6-tri(propan-2-yl)phenyl]prop-1-enoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-3-[2,4,6-tri(propan-2-yl)phenyl]prop-1-enoxy]oxane?
The IUPAC name of 2-[(E)-3-[2,4,6-tri(propan-2-yl)phenyl]prop-1-enoxy]oxane (CID 11221645) is 2-[(E)-3-[2,4,6-tri(propan-2-yl)phenyl]prop-1-enoxy]oxane.
What is the SMILES notation for 2-[(E)-3-[2,4,6-tri(propan-2-yl)phenyl]prop-1-enoxy]oxane?
The canonical SMILES for 2-[(E)-3-[2,4,6-tri(propan-2-yl)phenyl]prop-1-enoxy]oxane is CC(C)c1cc(C(C)C)c(C/C=C/OC2CCCCO2)c(C(C)C)c1.
What is the InChIKey of 2-[(E)-3-[2,4,6-tri(propan-2-yl)phenyl]prop-1-enoxy]oxane?
The InChIKey is FLCRLHPPZBQDTR-UKTHLTGXSA-N. The full InChI is InChI=1S/C23H36O2/c1-16(2)19-14-21(17(3)4)20(22(15-19)18(5)6)10-9-13-25-23-11-7-8-12-24-23/h9,13-18,23H,7-8,10-12H2,1-6H3/b13-9+.
What are the key properties of 2-[(E)-3-[2,4,6-tri(propan-2-yl)phenyl]prop-1-enoxy]oxane?
2-[(E)-3-[2,4,6-tri(propan-2-yl)phenyl]prop-1-enoxy]oxane has a molecular weight of 344.54 g/mol, XLogP of 6.66, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-3-[2,4,6-tri(propan-2-yl)phenyl]prop-1-enoxy]oxane is sourced from PubChem (CID 11221645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).