About N-(7-chloro-2-methyl-1,8-naphthyridin-4-yl)-2-(trifluoromethyl)-1,3-thiazol-5-amine
N-(7-chloro-2-methyl-1,8-naphthyridin-4-yl)-2-(trifluoromethyl)-1,3-thiazol-5-amine (PubChem CID 11221649) has the molecular formula C13H8ClF3N4S
and a molecular weight of 344.75 g/mol. Its IUPAC name is N-(7-chloro-2-methyl-1,8-naphthyridin-4-yl)-2-(trifluoromethyl)-1,3-thiazol-5-amine.
Molecular Properties
| Compound Name | N-(7-chloro-2-methyl-1,8-naphthyridin-4-yl)-2-(trifluoromethyl)-1,3-thiazol-5-amine |
| PubChem CID | 11221649 |
| Molecular Formula | C13H8ClF3N4S |
| Molecular Weight | 344.75 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | N-(7-chloro-2-methyl-1,8-naphthyridin-4-yl)-2-(trifluoromethyl)-1,3-thiazol-5-amine |
| SMILES | Cc1cc(Nc2cnc(C(F)(F)F)s2)c2ccc(Cl)nc2n1 |
| InChI | InChI=1S/C13H8ClF3N4S/c1-6-4-8(7-2-3-9(14)21-11(7)19-6)20-10-5-18-12(22-10)13(15,16)17/h2-5H,1H3,(H,19,20,21) |
| InChIKey | DIZFFTNLVYDUSF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.75 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-(7-chloro-2-methyl-1,8-naphthyridin-4-yl)-2-(trifluoromethyl)-1,3-thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7-chloro-2-methyl-1,8-naphthyridin-4-yl)-2-(trifluoromethyl)-1,3-thiazol-5-amine?
The IUPAC name of N-(7-chloro-2-methyl-1,8-naphthyridin-4-yl)-2-(trifluoromethyl)-1,3-thiazol-5-amine (CID 11221649) is N-(7-chloro-2-methyl-1,8-naphthyridin-4-yl)-2-(trifluoromethyl)-1,3-thiazol-5-amine.
What is the SMILES notation for N-(7-chloro-2-methyl-1,8-naphthyridin-4-yl)-2-(trifluoromethyl)-1,3-thiazol-5-amine?
The canonical SMILES for N-(7-chloro-2-methyl-1,8-naphthyridin-4-yl)-2-(trifluoromethyl)-1,3-thiazol-5-amine is Cc1cc(Nc2cnc(C(F)(F)F)s2)c2ccc(Cl)nc2n1.
What is the InChIKey of N-(7-chloro-2-methyl-1,8-naphthyridin-4-yl)-2-(trifluoromethyl)-1,3-thiazol-5-amine?
The InChIKey is DIZFFTNLVYDUSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClF3N4S/c1-6-4-8(7-2-3-9(14)21-11(7)19-6)20-10-5-18-12(22-10)13(15,16)17/h2-5H,1H3,(H,19,20,21).
What are the key properties of N-(7-chloro-2-methyl-1,8-naphthyridin-4-yl)-2-(trifluoromethyl)-1,3-thiazol-5-amine?
N-(7-chloro-2-methyl-1,8-naphthyridin-4-yl)-2-(trifluoromethyl)-1,3-thiazol-5-amine has a molecular weight of 344.75 g/mol, XLogP of 4.81, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7-chloro-2-methyl-1,8-naphthyridin-4-yl)-2-(trifluoromethyl)-1,3-thiazol-5-amine is sourced from PubChem (CID 11221649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).