C22H26N4 — CID 11221722
N-(11,13-dimethyl-11,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaen-16-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 11221722) has the molecular formula C22H26N4 and a molecular weight of 346.48 g/mol. Its IUPAC name is N-(11,13-dimethyl-11,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaen-16-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(11,13-dimethyl-11,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaen-16-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 11221722 |
| Molecular Formula | C22H26N4 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | N-(11,13-dimethyl-11,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaen-16-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | Cc1cnc(NCCCN(C)C)c2c3c4ccccc4ccc3n(C)c12 |
| InChI | InChI=1S/C22H26N4/c1-15-14-24-22(23-12-7-13-25(2)3)20-19-17-9-6-5-8-16(17)10-11-18(19)26(4)21(15)20/h5-6,8-11,14H,7,12-13H2,1-4H3,(H,23,24) |
| InChIKey | SOKPEOGFYIVXNB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|