C17H25ClN4O2 — CID 11221916
2-(9-oxo-8-aza-5-azoniaspiro[4.5]decan-8-yl)-N-(2-pyridin-2-ylethyl)acetamide chloride (PubChem CID 11221916) has the molecular formula C17H25ClN4O2 and a molecular weight of 352.87 g/mol. Its IUPAC name is 2-(9-oxo-8-aza-5-azoniaspiro[4.5]decan-8-yl)-N-(2-pyridin-2-ylethyl)acetamide chloride.
| Compound Name | 2-(9-oxo-8-aza-5-azoniaspiro[4.5]decan-8-yl)-N-(2-pyridin-2-ylethyl)acetamide chloride |
|---|---|
| PubChem CID | 11221916 |
| Molecular Formula | C17H25ClN4O2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 2-(9-oxo-8-aza-5-azoniaspiro[4.5]decan-8-yl)-N-(2-pyridin-2-ylethyl)acetamide chloride |
| SMILES | O=C(CN1CC[N+]2(CCCC2)CC1=O)NCCc1ccccn1.[Cl-] |
| InChI | InChI=1S/C17H24N4O2.ClH/c22-16(19-8-6-15-5-1-2-7-18-15)13-20-9-12-21(14-17(20)23)10-3-4-11-21;/h1-2,5,7H,3-4,6,8-14H2;1H |
| InChIKey | RLAHFQNODIUEBT-UHFFFAOYSA-N |
| XLogP | -2.80 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|