About tributyl-[(1E)-2-methylbuta-1,3-dienyl]stannane
tributyl-[(1E)-2-methylbuta-1,3-dienyl]stannane (PubChem CID 11222036) has the molecular formula C17H34Sn
and a molecular weight of 357.17 g/mol. Its IUPAC name is tributyl-[(1E)-2-methylbuta-1,3-dienyl]stannane.
Molecular Properties
| Compound Name | tributyl-[(1E)-2-methylbuta-1,3-dienyl]stannane |
| PubChem CID | 11222036 |
| Molecular Formula | C17H34Sn |
| Molecular Weight | 357.17 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | tributyl-[(1E)-2-methylbuta-1,3-dienyl]stannane |
| SMILES | C=C/C(C)=C/[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C5H7.3C4H9.Sn/c1-4-5(2)3;3*1-3-4-2;/h2,4H,1H2,3H3;3*1,3-4H2,2H3; |
| InChIKey | VWWNNDHDHDQVLZ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.17 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tributyl-[(1E)-2-methylbuta-1,3-dienyl]stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-[(1E)-2-methylbuta-1,3-dienyl]stannane?
The IUPAC name of tributyl-[(1E)-2-methylbuta-1,3-dienyl]stannane (CID 11222036) is tributyl-[(1E)-2-methylbuta-1,3-dienyl]stannane.
What is the SMILES notation for tributyl-[(1E)-2-methylbuta-1,3-dienyl]stannane?
The canonical SMILES for tributyl-[(1E)-2-methylbuta-1,3-dienyl]stannane is C=C/C(C)=C/[Sn](CCCC)(CCCC)CCCC.
What is the InChIKey of tributyl-[(1E)-2-methylbuta-1,3-dienyl]stannane?
The InChIKey is VWWNNDHDHDQVLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7.3C4H9.Sn/c1-4-5(2)3;3*1-3-4-2;/h2,4H,1H2,3H3;3*1,3-4H2,2H3;.
What are the key properties of tributyl-[(1E)-2-methylbuta-1,3-dienyl]stannane?
tributyl-[(1E)-2-methylbuta-1,3-dienyl]stannane has a molecular weight of 357.17 g/mol, XLogP of 6.51, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-[(1E)-2-methylbuta-1,3-dienyl]stannane is sourced from PubChem (CID 11222036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).