C19H17FO4S — CID 11222135
5-(3-fluoro-4-methylsulfonylphenyl)-2,2-dimethyl-4-phenylfuran-3-one (PubChem CID 11222135) has the molecular formula C19H17FO4S and a molecular weight of 360.41 g/mol. Its IUPAC name is 5-(3-fluoro-4-methylsulfonylphenyl)-2,2-dimethyl-4-phenylfuran-3-one.
| Compound Name | 5-(3-fluoro-4-methylsulfonylphenyl)-2,2-dimethyl-4-phenylfuran-3-one |
|---|---|
| PubChem CID | 11222135 |
| Molecular Formula | C19H17FO4S |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 5-(3-fluoro-4-methylsulfonylphenyl)-2,2-dimethyl-4-phenylfuran-3-one |
| SMILES | CC1(C)OC(c2ccc(S(C)(=O)=O)c(F)c2)=C(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H17FO4S/c1-19(2)18(21)16(12-7-5-4-6-8-12)17(24-19)13-9-10-15(14(20)11-13)25(3,22)23/h4-11H,1-3H3 |
| InChIKey | CKKYCUXJFUYTIV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|