C21H28O5 — CID 11222143
(1S,3R,6R,8S,10R,12S,13R)-12-ethenyl-1,3,12-trimethyl-6-phenyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-ol (PubChem CID 11222143) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is (1S,3R,6R,8S,10R,12S,13R)-12-ethenyl-1,3,12-trimethyl-6-phenyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-ol.
| Compound Name | (1S,3R,6R,8S,10R,12S,13R)-12-ethenyl-1,3,12-trimethyl-6-phenyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-ol |
|---|---|
| PubChem CID | 11222143 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (1S,3R,6R,8S,10R,12S,13R)-12-ethenyl-1,3,12-trimethyl-6-phenyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-ol |
| SMILES | C=C[C@]1(C)O[C@@H]2C[C@@H]3O[C@H](c4ccccc4)OC[C@@]3(C)O[C@@]2(C)C[C@H]1O |
| InChI | InChI=1S/C21H28O5/c1-5-19(2)15(22)12-20(3)17(25-19)11-16-21(4,26-20)13-23-18(24-16)14-9-7-6-8-10-14/h5-10,15-18,22H,1,11-13H2,2-4H3/t15-,16+,17-,18-,19+,20+,21-/m1/s1 |
| InChIKey | BODPKBBJRVVRPA-LTGKAUERSA-N |
| XLogP | 3.13 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|