About methyl 2-[acetyloxy-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]prop-2-enoate
methyl 2-[acetyloxy-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]prop-2-enoate (PubChem CID 11222452) has the molecular formula C16H13Cl2NO5
and a molecular weight of 370.19 g/mol. Its IUPAC name is methyl 2-[acetyloxy-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]prop-2-enoate.
Molecular Properties
| Compound Name | methyl 2-[acetyloxy-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]prop-2-enoate |
| PubChem CID | 11222452 |
| Molecular Formula | C16H13Cl2NO5 |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | methyl 2-[acetyloxy-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)C(OC(C)=O)c1cc(-c2ccc(Cl)cc2Cl)no1 |
| InChI | InChI=1S/C16H13Cl2NO5/c1-8(16(21)22-3)15(23-9(2)20)14-7-13(19-24-14)11-5-4-10(17)6-12(11)18/h4-7,15H,1H2,2-3H3 |
| InChIKey | YGKLITORTONEJM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[acetyloxy-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[acetyloxy-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]prop-2-enoate?
The IUPAC name of methyl 2-[acetyloxy-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]prop-2-enoate (CID 11222452) is methyl 2-[acetyloxy-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]prop-2-enoate.
What is the SMILES notation for methyl 2-[acetyloxy-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]prop-2-enoate?
The canonical SMILES for methyl 2-[acetyloxy-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]prop-2-enoate is C=C(C(=O)OC)C(OC(C)=O)c1cc(-c2ccc(Cl)cc2Cl)no1.
What is the InChIKey of methyl 2-[acetyloxy-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]prop-2-enoate?
The InChIKey is YGKLITORTONEJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13Cl2NO5/c1-8(16(21)22-3)15(23-9(2)20)14-7-13(19-24-14)11-5-4-10(17)6-12(11)18/h4-7,15H,1H2,2-3H3.
What are the key properties of methyl 2-[acetyloxy-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]prop-2-enoate?
methyl 2-[acetyloxy-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]prop-2-enoate has a molecular weight of 370.19 g/mol, XLogP of 3.98, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[acetyloxy-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]prop-2-enoate is sourced from PubChem (CID 11222452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).