About N-(1,3-diphenylpyrazol-5-yl)-3,4-difluorobenzamide
N-(1,3-diphenylpyrazol-5-yl)-3,4-difluorobenzamide (PubChem CID 11222596) has the molecular formula C22H15F2N3O
and a molecular weight of 375.38 g/mol. Its IUPAC name is N-(1,3-diphenylpyrazol-5-yl)-3,4-difluorobenzamide.
Molecular Properties
| Compound Name | N-(1,3-diphenylpyrazol-5-yl)-3,4-difluorobenzamide |
| PubChem CID | 11222596 |
| Molecular Formula | C22H15F2N3O |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | N-(1,3-diphenylpyrazol-5-yl)-3,4-difluorobenzamide |
| SMILES | O=C(Nc1cc(-c2ccccc2)nn1-c1ccccc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H15F2N3O/c23-18-12-11-16(13-19(18)24)22(28)25-21-14-20(15-7-3-1-4-8-15)26-27(21)17-9-5-2-6-10-17/h1-14H,(H,25,28) |
| InChIKey | MZLFWWUYWRMFND-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1,3-diphenylpyrazol-5-yl)-3,4-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-diphenylpyrazol-5-yl)-3,4-difluorobenzamide?
The IUPAC name of N-(1,3-diphenylpyrazol-5-yl)-3,4-difluorobenzamide (CID 11222596) is N-(1,3-diphenylpyrazol-5-yl)-3,4-difluorobenzamide.
What is the SMILES notation for N-(1,3-diphenylpyrazol-5-yl)-3,4-difluorobenzamide?
The canonical SMILES for N-(1,3-diphenylpyrazol-5-yl)-3,4-difluorobenzamide is O=C(Nc1cc(-c2ccccc2)nn1-c1ccccc1)c1ccc(F)c(F)c1.
What is the InChIKey of N-(1,3-diphenylpyrazol-5-yl)-3,4-difluorobenzamide?
The InChIKey is MZLFWWUYWRMFND-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15F2N3O/c23-18-12-11-16(13-19(18)24)22(28)25-21-14-20(15-7-3-1-4-8-15)26-27(21)17-9-5-2-6-10-17/h1-14H,(H,25,28).
What are the key properties of N-(1,3-diphenylpyrazol-5-yl)-3,4-difluorobenzamide?
N-(1,3-diphenylpyrazol-5-yl)-3,4-difluorobenzamide has a molecular weight of 375.38 g/mol, XLogP of 5.07, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-diphenylpyrazol-5-yl)-3,4-difluorobenzamide is sourced from PubChem (CID 11222596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).