C13H4F8S2 — CID 11222609
2-fluoro-3-[3,3,4,4,5,5-hexafluoro-2-(2-fluorothiophen-3-yl)cyclopenten-1-yl]thiophene (PubChem CID 11222609) has the molecular formula C13H4F8S2 and a molecular weight of 376.29 g/mol. Its IUPAC name is 2-fluoro-3-[3,3,4,4,5,5-hexafluoro-2-(2-fluorothiophen-3-yl)cyclopenten-1-yl]thiophene.
| Compound Name | 2-fluoro-3-[3,3,4,4,5,5-hexafluoro-2-(2-fluorothiophen-3-yl)cyclopenten-1-yl]thiophene |
|---|---|
| PubChem CID | 11222609 |
| Molecular Formula | C13H4F8S2 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.96 |
| IUPAC Name | 2-fluoro-3-[3,3,4,4,5,5-hexafluoro-2-(2-fluorothiophen-3-yl)cyclopenten-1-yl]thiophene |
| SMILES | Fc1sccc1C1=C(c2ccsc2F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C13H4F8S2/c14-9-5(1-3-22-9)7-8(6-2-4-23-10(6)15)12(18,19)13(20,21)11(7,16)17/h1-4H |
| InChIKey | CVCSXLROYKSXFX-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|