About 3,5-bis(4-methylsulfanylphenyl)-1,2,4-selenadiazole
3,5-bis(4-methylsulfanylphenyl)-1,2,4-selenadiazole (PubChem CID 11222642) has the molecular formula C16H14N2S2Se
and a molecular weight of 377.40 g/mol. Its IUPAC name is 3,5-bis(4-methylsulfanylphenyl)-1,2,4-selenadiazole.
Molecular Properties
| Compound Name | 3,5-bis(4-methylsulfanylphenyl)-1,2,4-selenadiazole |
| PubChem CID | 11222642 |
| Molecular Formula | C16H14N2S2Se |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | 3,5-bis(4-methylsulfanylphenyl)-1,2,4-selenadiazole |
| SMILES | CSc1ccc(-c2n[se]c(-c3ccc(SC)cc3)n2)cc1 |
| InChI | InChI=1S/C16H14N2S2Se/c1-19-13-7-3-11(4-8-13)15-17-16(21-18-15)12-5-9-14(20-2)10-6-12/h3-10H,1-2H3 |
| InChIKey | MHECHCYWUUBUNM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3,5-bis(4-methylsulfanylphenyl)-1,2,4-selenadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(4-methylsulfanylphenyl)-1,2,4-selenadiazole?
The IUPAC name of 3,5-bis(4-methylsulfanylphenyl)-1,2,4-selenadiazole (CID 11222642) is 3,5-bis(4-methylsulfanylphenyl)-1,2,4-selenadiazole.
What is the SMILES notation for 3,5-bis(4-methylsulfanylphenyl)-1,2,4-selenadiazole?
The canonical SMILES for 3,5-bis(4-methylsulfanylphenyl)-1,2,4-selenadiazole is CSc1ccc(-c2n[se]c(-c3ccc(SC)cc3)n2)cc1.
What is the InChIKey of 3,5-bis(4-methylsulfanylphenyl)-1,2,4-selenadiazole?
The InChIKey is MHECHCYWUUBUNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2S2Se/c1-19-13-7-3-11(4-8-13)15-17-16(21-18-15)12-5-9-14(20-2)10-6-12/h3-10H,1-2H3.
What are the key properties of 3,5-bis(4-methylsulfanylphenyl)-1,2,4-selenadiazole?
3,5-bis(4-methylsulfanylphenyl)-1,2,4-selenadiazole has a molecular weight of 377.40 g/mol, XLogP of 4.31, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(4-methylsulfanylphenyl)-1,2,4-selenadiazole is sourced from PubChem (CID 11222642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).