C17H19NO7S — CID 11222754
[(3aR,4S,6R,7S,7aR)-7-acetyloxy-2-oxo-4-phenylsulfanyl-3,3a,4,6,7,7a-hexahydropyrano[3,4-d][1,3]oxazol-6-yl]methyl acetate (PubChem CID 11222754) has the molecular formula C17H19NO7S and a molecular weight of 381.41 g/mol. Its IUPAC name is [(3aR,4S,6R,7S,7aR)-7-acetyloxy-2-oxo-4-phenylsulfanyl-3,3a,4,6,7,7a-hexahydropyrano[3,4-d][1,3]oxazol-6-yl]methyl acetate.
| Compound Name | [(3aR,4S,6R,7S,7aR)-7-acetyloxy-2-oxo-4-phenylsulfanyl-3,3a,4,6,7,7a-hexahydropyrano[3,4-d][1,3]oxazol-6-yl]methyl acetate |
|---|---|
| PubChem CID | 11222754 |
| Molecular Formula | C17H19NO7S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | [(3aR,4S,6R,7S,7aR)-7-acetyloxy-2-oxo-4-phenylsulfanyl-3,3a,4,6,7,7a-hexahydropyrano[3,4-d][1,3]oxazol-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Sc2ccccc2)[C@@H]2NC(=O)O[C@H]2[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H19NO7S/c1-9(19)22-8-12-14(23-10(2)20)15-13(18-17(21)25-15)16(24-12)26-11-6-4-3-5-7-11/h3-7,12-16H,8H2,1-2H3,(H,18,21)/t12-,13-,14-,15-,16+/m1/s1 |
| InChIKey | XSCAZNVJOYZMRA-QCODTGAPSA-N |
| XLogP | 1.48 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|