C15H16N10OS — CID 11222837
2-(furan-2-yl)-5-[4-(thiadiazol-4-ylmethyl)piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 11222837) has the molecular formula C15H16N10OS and a molecular weight of 384.43 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-[4-(thiadiazol-4-ylmethyl)piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 2-(furan-2-yl)-5-[4-(thiadiazol-4-ylmethyl)piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 11222837 |
| Molecular Formula | C15H16N10OS |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 2-(furan-2-yl)-5-[4-(thiadiazol-4-ylmethyl)piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | Nc1nc(N2CCN(Cc3csnn3)CC2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C15H16N10OS/c16-13-18-14(19-15-17-12(21-25(13)15)11-2-1-7-26-11)24-5-3-23(4-6-24)8-10-9-27-22-20-10/h1-2,7,9H,3-6,8H2,(H2,16,17,18,19,21) |
| InChIKey | RJORFDZLKBGWOF-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |