C21H20O5S — CID 11222843
4-(4-acetylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one (PubChem CID 11222843) has the molecular formula C21H20O5S and a molecular weight of 384.45 g/mol. Its IUPAC name is 4-(4-acetylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one.
| Compound Name | 4-(4-acetylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one |
|---|---|
| PubChem CID | 11222843 |
| Molecular Formula | C21H20O5S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 4-(4-acetylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one |
| SMILES | CC(=O)c1ccc(C2=C(c3ccc(S(C)(=O)=O)cc3)OC(C)(C)C2=O)cc1 |
| InChI | InChI=1S/C21H20O5S/c1-13(22)14-5-7-15(8-6-14)18-19(26-21(2,3)20(18)23)16-9-11-17(12-10-16)27(4,24)25/h5-12H,1-4H3 |
| InChIKey | CKUOBHLRNGAPLL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|